C13H15N3O4S — CID 137078288
methyl 5-(2-ethoxyethylsulfanyl)-7-imino-4-oxo-2H-indazole-3-carboxylate (PubChem CID 137078288) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is methyl 5-(2-ethoxyethylsulfanyl)-7-imino-4-oxo-2H-indazole-3-carboxylate.
| Compound Name | methyl 5-(2-ethoxyethylsulfanyl)-7-imino-4-oxo-2H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 137078288 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | methyl 5-(2-ethoxyethylsulfanyl)-7-imino-4-oxo-2H-indazole-3-carboxylate |
| SMILES | [H]/N=C1\C=C(SCCOCC)C(=O)c2c1n[nH]c2C(=O)OC |
| InChI | InChI=1S/C13H15N3O4S/c1-3-20-4-5-21-8-6-7(14)10-9(12(8)17)11(16-15-10)13(18)19-2/h6,14H,3-5H2,1-2H3,(H,15,16)/b14-7+ |
| InChIKey | HJBJTMIATJPBAP-VGOFMYFVSA-N |
| XLogP | 1.41 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|