About methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate
methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate (PubChem CID 84679040) has the molecular formula C8H8N2O3S
and a molecular weight of 212.23 g/mol. Its IUPAC name is methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate.
Analyze methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate?
The IUPAC name of methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate (CID 84679040) is methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate.
What is the SMILES notation for methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate?
The canonical SMILES for methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate is COC(=O)c1[nH]nc2c1CSCC2=O.
What is the InChIKey of methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate?
The InChIKey is NXHZHDBFSFVSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S/c1-13-8(12)7-4-2-14-3-5(11)6(4)9-10-7/h2-3H2,1H3,(H,9,10).
What are the key properties of methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate?
methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate has a molecular weight of 212.23 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-oxo-2,4-dihydrothiopyrano[4,3-c]pyrazole-3-carboxylate is sourced from PubChem (CID 84679040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).