C15H13N3O4S2 — CID 12826582
methyl 8-methyl-9,9-dioxo-9λ6,17-dithia-8,12,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11,14-hexaene-14-carboxylate (PubChem CID 12826582) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 8-methyl-9,9-dioxo-9λ6,17-dithia-8,12,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11,14-hexaene-14-carboxylate.
| Compound Name | methyl 8-methyl-9,9-dioxo-9λ6,17-dithia-8,12,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11,14-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 12826582 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | methyl 8-methyl-9,9-dioxo-9λ6,17-dithia-8,12,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11,14-hexaene-14-carboxylate |
| SMILES | COC(=O)c1[nH]nc2c1CSC1=C2S(=O)(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C15H13N3O4S2/c1-18-10-6-4-3-5-8(10)13-14(24(18,20)21)11-9(7-23-13)12(17-16-11)15(19)22-2/h3-6H,7H2,1-2H3,(H,16,17) |
| InChIKey | RKKRVLWOULDPRJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |