C19H18N4O6S — CID 123306918
4,7-dioxo-5-[2-[2-(phenylcarbamoylamino)ethoxy]ethylsulfanyl]-2H-indazole-3-carboxylic acid (PubChem CID 123306918) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is 4,7-dioxo-5-[2-[2-(phenylcarbamoylamino)ethoxy]ethylsulfanyl]-2H-indazole-3-carboxylic acid.
| Compound Name | 4,7-dioxo-5-[2-[2-(phenylcarbamoylamino)ethoxy]ethylsulfanyl]-2H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 123306918 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4,7-dioxo-5-[2-[2-(phenylcarbamoylamino)ethoxy]ethylsulfanyl]-2H-indazole-3-carboxylic acid |
| SMILES | O=C(NCCOCCSC1=CC(=O)c2n[nH]c(C(=O)O)c2C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H18N4O6S/c24-12-10-13(17(25)14-15(12)22-23-16(14)18(26)27)30-9-8-29-7-6-20-19(28)21-11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,22,23)(H,26,27)(H2,20,21,28) |
| InChIKey | MTKOZUFHQPBUJP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|