C18H17N3O6S — CID 123344818
methyl 7-hydroxy-4-oxo-5-[2-(phenylcarbamoylamino)ethylsulfanyl]-7H-1,2-benzoxazole-3-carboxylate (PubChem CID 123344818) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is methyl 7-hydroxy-4-oxo-5-[2-(phenylcarbamoylamino)ethylsulfanyl]-7H-1,2-benzoxazole-3-carboxylate.
| Compound Name | methyl 7-hydroxy-4-oxo-5-[2-(phenylcarbamoylamino)ethylsulfanyl]-7H-1,2-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 123344818 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | methyl 7-hydroxy-4-oxo-5-[2-(phenylcarbamoylamino)ethylsulfanyl]-7H-1,2-benzoxazole-3-carboxylate |
| SMILES | COC(=O)c1noc2c1C(=O)C(SCCNC(=O)Nc1ccccc1)=CC2O |
| InChI | InChI=1S/C18H17N3O6S/c1-26-17(24)14-13-15(23)12(9-11(22)16(13)27-21-14)28-8-7-19-18(25)20-10-5-3-2-4-6-10/h2-6,9,11,22H,7-8H2,1H3,(H2,19,20,25) |
| InChIKey | RIOGWCMHGSTBMN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|