C18H12N2O5 — CID 177373926
3,7-dimethyl-4,8-dioxo-N-phenylfuro[2,3-f][1,2]benzoxazole-6-carboxamide (PubChem CID 177373926) has the molecular formula C18H12N2O5 and a molecular weight of 336.30 g/mol. Its IUPAC name is 3,7-dimethyl-4,8-dioxo-N-phenylfuro[2,3-f][1,2]benzoxazole-6-carboxamide.
| Compound Name | 3,7-dimethyl-4,8-dioxo-N-phenylfuro[2,3-f][1,2]benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 177373926 |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 3,7-dimethyl-4,8-dioxo-N-phenylfuro[2,3-f][1,2]benzoxazole-6-carboxamide |
| SMILES | Cc1noc2c1C(=O)c1oc(C(=O)Nc3ccccc3)c(C)c1C2=O |
| InChI | InChI=1S/C18H12N2O5/c1-8-11-13(21)17-12(9(2)20-25-17)14(22)16(11)24-15(8)18(23)19-10-6-4-3-5-7-10/h3-7H,1-2H3,(H,19,23) |
| InChIKey | MFWWESTXIIWKOU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|