C18H17N3O4 — CID 146080882
N-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)furan-2-yl]methyl]-N'-phenyloxamide (PubChem CID 146080882) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)furan-2-yl]methyl]-N'-phenyloxamide.
| Compound Name | N-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)furan-2-yl]methyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 146080882 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)furan-2-yl]methyl]-N'-phenyloxamide |
| SMILES | Cc1noc(C)c1-c1ccc(CNC(=O)C(=O)Nc2ccccc2)o1 |
| InChI | InChI=1S/C18H17N3O4/c1-11-16(12(2)25-21-11)15-9-8-14(24-15)10-19-17(22)18(23)20-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | CYBMYLREOPJQBT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|