About N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide
N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide (PubChem CID 175902717) has the molecular formula C15H11NO4
and a molecular weight of 269.26 g/mol. Its IUPAC name is N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide |
| PubChem CID | 175902717 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide |
| SMILES | CNC(=O)c1oc2c(c1C)C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C15H11NO4/c1-7-10-12(18)11(17)8-5-3-4-6-9(8)14(10)20-13(7)15(19)16-2/h3-6H,1-2H3,(H,16,19) |
| InChIKey | UUTGWYDBVLIRCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide?
The IUPAC name of N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide (CID 175902717) is N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide.
What is the SMILES notation for N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide?
The canonical SMILES for N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide is CNC(=O)c1oc2c(c1C)C(=O)C(=O)c1ccccc1-2.
What is the InChIKey of N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide?
The InChIKey is UUTGWYDBVLIRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO4/c1-7-10-12(18)11(17)8-5-3-4-6-9(8)14(10)20-13(7)15(19)16-2/h3-6H,1-2H3,(H,16,19).
What are the key properties of N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide?
N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide has a molecular weight of 269.26 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide is sourced from PubChem (CID 175902717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).