C15H11NO4 — CID 175902717
N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide (PubChem CID 175902717) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide.
| Compound Name | N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 175902717 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N,3-dimethyl-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide |
| SMILES | CNC(=O)c1oc2c(c1C)C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C15H11NO4/c1-7-10-12(18)11(17)8-5-3-4-6-9(8)14(10)20-13(7)15(19)16-2/h3-6H,1-2H3,(H,16,19) |
| InChIKey | UUTGWYDBVLIRCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|