C14H9BrO3 — CID 85470386
2-(bromomethyl)-3-methylbenzo[g][1]benzofuran-4,5-dione (PubChem CID 85470386) has the molecular formula C14H9BrO3 and a molecular weight of 305.13 g/mol. Its IUPAC name is 2-(bromomethyl)-3-methylbenzo[g][1]benzofuran-4,5-dione.
| Compound Name | 2-(bromomethyl)-3-methylbenzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 85470386 |
| Molecular Formula | C14H9BrO3 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 2-(bromomethyl)-3-methylbenzo[g][1]benzofuran-4,5-dione |
| SMILES | Cc1c(CBr)oc2c1C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C14H9BrO3/c1-7-10(6-15)18-14-9-5-3-2-4-8(9)12(16)13(17)11(7)14/h2-5H,6H2,1H3 |
| InChIKey | UCVHQIJFIRZHRJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|