C20H21NO3 — CID 90682682
2-[(cyclohexylamino)methyl]-3-methylbenzo[g][1]benzofuran-4,5-dione (PubChem CID 90682682) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[(cyclohexylamino)methyl]-3-methylbenzo[g][1]benzofuran-4,5-dione.
| Compound Name | 2-[(cyclohexylamino)methyl]-3-methylbenzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 90682682 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[(cyclohexylamino)methyl]-3-methylbenzo[g][1]benzofuran-4,5-dione |
| SMILES | Cc1c(CNC2CCCCC2)oc2c1C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H21NO3/c1-12-16(11-21-13-7-3-2-4-8-13)24-20-15-10-6-5-9-14(15)18(22)19(23)17(12)20/h5-6,9-10,13,21H,2-4,7-8,11H2,1H3 |
| InChIKey | WQAYVQMOYOURCP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|