C56H84N16O2 — CID 163452997
1,4-bis[[4,6-bis[3-(cyclohexylamino)propylamino]-1,3,5-triazin-2-yl]amino]anthracene-9,10-dione (PubChem CID 163452997) has the molecular formula C56H84N16O2 and a molecular weight of 1013.40 g/mol. Its IUPAC name is 1,4-bis[[4,6-bis[3-(cyclohexylamino)propylamino]-1,3,5-triazin-2-yl]amino]anthracene-9,10-dione.
| Compound Name | 1,4-bis[[4,6-bis[3-(cyclohexylamino)propylamino]-1,3,5-triazin-2-yl]amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 163452997 |
| Molecular Formula | C56H84N16O2 |
| Molecular Weight | 1013.40 g/mol |
| Exact Mass | 1012.70 |
| IUPAC Name | 1,4-bis[[4,6-bis[3-(cyclohexylamino)propylamino]-1,3,5-triazin-2-yl]amino]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(Nc3nc(NCCCNC4CCCCC4)nc(NCCCNC4CCCCC4)n3)ccc(Nc3nc(NCCCNC4CCCCC4)nc(NCCCNC4CCCCC4)n3)c21 |
| InChI | InChI=1S/C56H84N16O2/c73-49-43-27-13-14-28-44(43)50(74)48-46(66-56-71-53(63-37-17-33-59-41-23-9-3-10-24-41)68-54(72-56)64-38-18-34-60-42-25-11-4-12-26-42)30-29-45(47(48)49)65-55-69-51(61-35-15-31-57-39-19-5-1-6-20-39)67-52(70-55)62-36-16-32-58-40-21-7-2-8-22-40/h13-14,27-30,39-42,57-60H,1-12,15-26,31-38H2,(H3,61,62,65,67,69,70)(H3,63,64,66,68,71,72) |
| InChIKey | BICFILPRDUUSNR-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 231.78 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 74 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.40 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|