C29H29N3O6S — CID 57353096
[3-[[4-(cyclohexylamino)-9,10-dioxoanthracen-1-yl]amino]propanoylamino] benzenesulfonate (PubChem CID 57353096) has the molecular formula C29H29N3O6S and a molecular weight of 547.63 g/mol. Its IUPAC name is [3-[[4-(cyclohexylamino)-9,10-dioxoanthracen-1-yl]amino]propanoylamino] benzenesulfonate.
| Compound Name | [3-[[4-(cyclohexylamino)-9,10-dioxoanthracen-1-yl]amino]propanoylamino] benzenesulfonate |
|---|---|
| PubChem CID | 57353096 |
| Molecular Formula | C29H29N3O6S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | [3-[[4-(cyclohexylamino)-9,10-dioxoanthracen-1-yl]amino]propanoylamino] benzenesulfonate |
| SMILES | O=C(CCNc1ccc(NC2CCCCC2)c2c1C(=O)c1ccccc1C2=O)NOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O6S/c33-25(32-38-39(36,37)20-11-5-2-6-12-20)17-18-30-23-15-16-24(31-19-9-3-1-4-10-19)27-26(23)28(34)21-13-7-8-14-22(21)29(27)35/h2,5-8,11-16,19,30-31H,1,3-4,9-10,17-18H2,(H,32,33) |
| InChIKey | CLQIIXAXUDFBOT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|