C20H19NO5S — CID 154315693
1-(cyclohexylamino)-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 154315693) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-(cyclohexylamino)-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-(cyclohexylamino)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 154315693 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-(cyclohexylamino)-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(S(=O)(=O)O)c2NC1CCCCC1 |
| InChI | InChI=1S/C20H19NO5S/c22-19-13-8-4-5-9-14(13)20(23)17-15(19)10-11-16(27(24,25)26)18(17)21-12-6-2-1-3-7-12/h4-5,8-12,21H,1-3,6-7H2,(H,24,25,26) |
| InChIKey | HHVRWKLOLSAZKF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|