C24H30N2O4 — CID 102309961
2,6-bis(cyclohexylamino)-3,7-dimethylfuro[2,3-f][1]benzofuran-4,8-dione (PubChem CID 102309961) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2,6-bis(cyclohexylamino)-3,7-dimethylfuro[2,3-f][1]benzofuran-4,8-dione.
| Compound Name | 2,6-bis(cyclohexylamino)-3,7-dimethylfuro[2,3-f][1]benzofuran-4,8-dione |
|---|---|
| PubChem CID | 102309961 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2,6-bis(cyclohexylamino)-3,7-dimethylfuro[2,3-f][1]benzofuran-4,8-dione |
| SMILES | Cc1c(NC2CCCCC2)oc2c1C(=O)c1oc(NC3CCCCC3)c(C)c1C2=O |
| InChI | InChI=1S/C24H30N2O4/c1-13-17-19(27)22-18(14(2)24(30-22)26-16-11-7-4-8-12-16)20(28)21(17)29-23(13)25-15-9-5-3-6-10-15/h15-16,25-26H,3-12H2,1-2H3 |
| InChIKey | XNSWQCVVYDYTBD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|