About dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate
dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate (PubChem CID 139223854) has the molecular formula C25H27NO7
and a molecular weight of 453.49 g/mol. Its IUPAC name is dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate |
| PubChem CID | 139223854 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(NC2CCCCC2)oc(-c2coc3cc(C)c(C)cc3c2=O)c1C(=O)OC |
| InChI | InChI=1S/C25H27NO7/c1-13-10-16-18(11-14(13)2)32-12-17(21(16)27)22-19(24(28)30-3)20(25(29)31-4)23(33-22)26-15-8-6-5-7-9-15/h10-12,15,26H,5-9H2,1-4H3 |
| InChIKey | NYTUXFONFTVHLU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate?
The IUPAC name of dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate (CID 139223854) is dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate.
What is the SMILES notation for dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate?
The canonical SMILES for dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate is COC(=O)c1c(NC2CCCCC2)oc(-c2coc3cc(C)c(C)cc3c2=O)c1C(=O)OC.
What is the InChIKey of dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate?
The InChIKey is NYTUXFONFTVHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO7/c1-13-10-16-18(11-14(13)2)32-12-17(21(16)27)22-19(24(28)30-3)20(25(29)31-4)23(33-22)26-15-8-6-5-7-9-15/h10-12,15,26H,5-9H2,1-4H3.
What are the key properties of dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate?
dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate has a molecular weight of 453.49 g/mol, XLogP of 4.99, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(cyclohexylamino)-5-(6,7-dimethyl-4-oxochromen-3-yl)furan-3,4-dicarboxylate is sourced from PubChem (CID 139223854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).