C23H23ClN2O5 — CID 102433074
dimethyl 2-(2-chloroquinolin-3-yl)-5-(cyclohexylamino)furan-3,4-dicarboxylate (PubChem CID 102433074) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is dimethyl 2-(2-chloroquinolin-3-yl)-5-(cyclohexylamino)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(2-chloroquinolin-3-yl)-5-(cyclohexylamino)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102433074 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | dimethyl 2-(2-chloroquinolin-3-yl)-5-(cyclohexylamino)furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(NC2CCCCC2)oc(-c2cc3ccccc3nc2Cl)c1C(=O)OC |
| InChI | InChI=1S/C23H23ClN2O5/c1-29-22(27)17-18(23(28)30-2)21(25-14-9-4-3-5-10-14)31-19(17)15-12-13-8-6-7-11-16(13)26-20(15)24/h6-8,11-12,14,25H,3-5,9-10H2,1-2H3 |
| InChIKey | FWQMIJBNRPUNLQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|