C23H37NO5 — CID 11223520
dimethyl 2-(cyclohexylamino)-5-nonylfuran-3,4-dicarboxylate (PubChem CID 11223520) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is dimethyl 2-(cyclohexylamino)-5-nonylfuran-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(cyclohexylamino)-5-nonylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11223520 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | dimethyl 2-(cyclohexylamino)-5-nonylfuran-3,4-dicarboxylate |
| SMILES | CCCCCCCCCc1oc(NC2CCCCC2)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C23H37NO5/c1-4-5-6-7-8-9-13-16-18-19(22(25)27-2)20(23(26)28-3)21(29-18)24-17-14-11-10-12-15-17/h17,24H,4-16H2,1-3H3 |
| InChIKey | RKDMXDXNMHGFAE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|