C7H12N2O — CID 122660422
5-ethyl-5-methyl-2-methylideneimidazolidin-4-one (PubChem CID 122660422) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 5-ethyl-5-methyl-2-methylideneimidazolidin-4-one.
| Compound Name | 5-ethyl-5-methyl-2-methylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 122660422 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 5-ethyl-5-methyl-2-methylideneimidazolidin-4-one |
| SMILES | C=C1NC(=O)C(C)(CC)N1 |
| InChI | InChI=1S/C7H12N2O/c1-4-7(3)6(10)8-5(2)9-7/h9H,2,4H2,1,3H3,(H,8,10) |
| InChIKey | OKUNQYIOUWZLJX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |