C11H20N2O2 — CID 64884043
3,3,6-triethyl-6-methylpiperazine-2,5-dione (PubChem CID 64884043) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3,3,6-triethyl-6-methylpiperazine-2,5-dione.
| Compound Name | 3,3,6-triethyl-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64884043 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 3,3,6-triethyl-6-methylpiperazine-2,5-dione |
| SMILES | CCC1(C)NC(=O)C(CC)(CC)NC1=O |
| InChI | InChI=1S/C11H20N2O2/c1-5-10(4)8(14)13-11(6-2,7-3)9(15)12-10/h5-7H2,1-4H3,(H,12,15)(H,13,14) |
| InChIKey | ZKDKDBDJWPIQLQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |