C18H15FINO3S — CID 122669090
9b-(4-fluorophenyl)sulfonyl-7-iodo-3,3a,4,5-tetrahydro-1H-benzo[e]indol-2-one (PubChem CID 122669090) has the molecular formula C18H15FINO3S and a molecular weight of 471.29 g/mol. Its IUPAC name is 9b-(4-fluorophenyl)sulfonyl-7-iodo-3,3a,4,5-tetrahydro-1H-benzo[e]indol-2-one.
| Compound Name | 9b-(4-fluorophenyl)sulfonyl-7-iodo-3,3a,4,5-tetrahydro-1H-benzo[e]indol-2-one |
|---|---|
| PubChem CID | 122669090 |
| Molecular Formula | C18H15FINO3S |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 470.98 |
| IUPAC Name | 9b-(4-fluorophenyl)sulfonyl-7-iodo-3,3a,4,5-tetrahydro-1H-benzo[e]indol-2-one |
| SMILES | O=C1CC2(S(=O)(=O)c3ccc(F)cc3)c3ccc(I)cc3CCC2N1 |
| InChI | InChI=1S/C18H15FINO3S/c19-12-2-5-14(6-3-12)25(23,24)18-10-17(22)21-16(18)8-1-11-9-13(20)4-7-15(11)18/h2-7,9,16H,1,8,10H2,(H,21,22) |
| InChIKey | FJHAYOACNLACMQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|