C32H31F4NO3 — CID 122676159
4-[9b-[(4-ethylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]benzoic acid (PubChem CID 122676159) has the molecular formula C32H31F4NO3 and a molecular weight of 553.60 g/mol. Its IUPAC name is 4-[9b-[(4-ethylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]benzoic acid.
| Compound Name | 4-[9b-[(4-ethylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 122676159 |
| Molecular Formula | C32H31F4NO3 |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 4-[9b-[(4-ethylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]benzoic acid |
| SMILES | CCc1ccc(CC23CCN(C(=O)c4ccc(C(=O)O)cc4)C2CCc2cc(C(C)(F)C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C32H31F4NO3/c1-3-20-4-6-21(7-5-20)19-31-16-17-37(28(38)22-8-10-23(11-9-22)29(39)40)27(31)15-12-24-18-25(13-14-26(24)31)30(2,33)32(34,35)36/h4-11,13-14,18,27H,3,12,15-17,19H2,1-2H3,(H,39,40) |
| InChIKey | PORGWCPOUYMNNN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |