C30H28F5N5 — CID 122676662
(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-3-[4-(2-methyltetrazol-5-yl)phenyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole (PubChem CID 122676662) has the molecular formula C30H28F5N5 and a molecular weight of 553.58 g/mol. Its IUPAC name is (3aR,9bS)-9b-[(4-fluorophenyl)methyl]-3-[4-(2-methyltetrazol-5-yl)phenyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole.
| Compound Name | (3aR,9bS)-9b-[(4-fluorophenyl)methyl]-3-[4-(2-methyltetrazol-5-yl)phenyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
|---|---|
| PubChem CID | 122676662 |
| Molecular Formula | C30H28F5N5 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | (3aR,9bS)-9b-[(4-fluorophenyl)methyl]-3-[4-(2-methyltetrazol-5-yl)phenyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
| SMILES | Cn1nnc(-c2ccc(N3CC[C@@]4(Cc5ccc(F)cc5)c5ccc(C(C)(F)C(F)(F)F)cc5CC[C@@H]34)cc2)n1 |
| InChI | InChI=1S/C30H28F5N5/c1-28(32,30(33,34)35)22-8-13-25-21(17-22)7-14-26-29(25,18-19-3-9-23(31)10-4-19)15-16-40(26)24-11-5-20(6-12-24)27-36-38-39(2)37-27/h3-6,8-13,17,26H,7,14-16,18H2,1-2H3/t26-,28?,29-/m1/s1 |
| InChIKey | GERUJAVMYXFDTA-OIKXHLBWSA-N |
| XLogP | 6.47 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |