C26H24F8N2O4S — CID 122679236
8b-(4-fluorophenyl)sulfonyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(oxan-4-yl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carboxamide (PubChem CID 122679236) has the molecular formula C26H24F8N2O4S and a molecular weight of 612.54 g/mol. Its IUPAC name is 8b-(4-fluorophenyl)sulfonyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(oxan-4-yl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carboxamide.
| Compound Name | 8b-(4-fluorophenyl)sulfonyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(oxan-4-yl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 122679236 |
| Molecular Formula | C26H24F8N2O4S |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 8b-(4-fluorophenyl)sulfonyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(oxan-4-yl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carboxamide |
| SMILES | O=C(NC1CCOCC1)N1CCC2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC12 |
| InChI | InChI=1S/C26H24F8N2O4S/c27-17-2-4-19(5-3-17)41(38,39)23-9-10-36(22(37)35-18-7-11-40-12-8-18)21(23)14-15-13-16(1-6-20(15)23)24(28,25(29,30)31)26(32,33)34/h1-6,13,18,21H,7-12,14H2,(H,35,37) |
| InChIKey | OCQDYRGXGGPYLB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |