C25H24F8N2O4S — CID 122679099
8b-(4-fluorophenyl)sulfonyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(2-hydroxy-2-methylpropyl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carboxamide (PubChem CID 122679099) has the molecular formula C25H24F8N2O4S and a molecular weight of 600.53 g/mol. Its IUPAC name is 8b-(4-fluorophenyl)sulfonyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(2-hydroxy-2-methylpropyl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carboxamide.
| Compound Name | 8b-(4-fluorophenyl)sulfonyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(2-hydroxy-2-methylpropyl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 122679099 |
| Molecular Formula | C25H24F8N2O4S |
| Molecular Weight | 600.53 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 8b-(4-fluorophenyl)sulfonyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(2-hydroxy-2-methylpropyl)-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrole-3-carboxamide |
| SMILES | CC(C)(O)CNC(=O)N1CCC2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC12 |
| InChI | InChI=1S/C25H24F8N2O4S/c1-21(2,37)13-34-20(36)35-10-9-22(40(38,39)17-6-4-16(26)5-7-17)18-8-3-15(11-14(18)12-19(22)35)23(27,24(28,29)30)25(31,32)33/h3-8,11,19,37H,9-10,12-13H2,1-2H3,(H,34,36) |
| InChIKey | BVMFCTGBLBEZTL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |