C26H30O5 — CID 122680531
(4aS,5aR,12aR)-2-acetyl-10,11-dihydroxy-3-methyl-7-pentyl-4,4a,5,5a,6,12a-hexahydrotetracene-1,12-dione (PubChem CID 122680531) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is (4aS,5aR,12aR)-2-acetyl-10,11-dihydroxy-3-methyl-7-pentyl-4,4a,5,5a,6,12a-hexahydrotetracene-1,12-dione.
| Compound Name | (4aS,5aR,12aR)-2-acetyl-10,11-dihydroxy-3-methyl-7-pentyl-4,4a,5,5a,6,12a-hexahydrotetracene-1,12-dione |
|---|---|
| PubChem CID | 122680531 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (4aS,5aR,12aR)-2-acetyl-10,11-dihydroxy-3-methyl-7-pentyl-4,4a,5,5a,6,12a-hexahydrotetracene-1,12-dione |
| SMILES | CCCCCc1ccc(O)c2c1C[C@H]1C[C@H]3CC(C)=C(C(C)=O)C(=O)[C@H]3C(=O)C1=C2O |
| InChI | InChI=1S/C26H30O5/c1-4-5-6-7-15-8-9-19(28)23-18(15)12-17-11-16-10-13(2)20(14(3)27)24(29)21(16)25(30)22(17)26(23)31/h8-9,16-17,21,28,31H,4-7,10-12H2,1-3H3/t16-,17-,21+/m1/s1 |
| InChIKey | MDUJXODPBHJBEC-LZJOCLMNSA-N |
| XLogP | 4.65 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|