C25H33N3O4S — CID 122684325
1-[4-[2-methoxy-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]piperazin-1-yl]ethanone (PubChem CID 122684325) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 1-[4-[2-methoxy-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-methoxy-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122684325 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 1-[4-[2-methoxy-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]piperazin-1-yl]ethanone |
| SMILES | COc1cc(CN2C(C)CCC(c3ccccc3)S2(=O)=O)ccc1N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C25H33N3O4S/c1-19-9-12-25(22-7-5-4-6-8-22)33(30,31)28(19)18-21-10-11-23(24(17-21)32-3)27-15-13-26(14-16-27)20(2)29/h4-8,10-11,17,19,25H,9,12-16,18H2,1-3H3 |
| InChIKey | AJBRTBJQFXTROM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|