C25H32FN3O2S — CID 122684356
2-[[4-(4-ethylpiperazin-1-yl)-2-fluorophenyl]methyl]-4-phenyl-3λ6-thia-2-azabicyclo[4.1.1]octane 3,3-dioxide (PubChem CID 122684356) has the molecular formula C25H32FN3O2S and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-[[4-(4-ethylpiperazin-1-yl)-2-fluorophenyl]methyl]-4-phenyl-3λ6-thia-2-azabicyclo[4.1.1]octane 3,3-dioxide.
| Compound Name | 2-[[4-(4-ethylpiperazin-1-yl)-2-fluorophenyl]methyl]-4-phenyl-3λ6-thia-2-azabicyclo[4.1.1]octane 3,3-dioxide |
|---|---|
| PubChem CID | 122684356 |
| Molecular Formula | C25H32FN3O2S |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-[[4-(4-ethylpiperazin-1-yl)-2-fluorophenyl]methyl]-4-phenyl-3λ6-thia-2-azabicyclo[4.1.1]octane 3,3-dioxide |
| SMILES | CCN1CCN(c2ccc(CN3C4CC(C4)CC(c4ccccc4)S3(=O)=O)c(F)c2)CC1 |
| InChI | InChI=1S/C25H32FN3O2S/c1-2-27-10-12-28(13-11-27)22-9-8-21(24(26)17-22)18-29-23-14-19(15-23)16-25(32(29,30)31)20-6-4-3-5-7-20/h3-9,17,19,23,25H,2,10-16,18H2,1H3 |
| InChIKey | IRMQLKULADGLLS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|