C27H29F3N4O5 — CID 122690368
N-hydroxy-2-[1-[(3-methoxypropylamino)methyl]-4-phenylcyclohexa-2,4-dien-1-yl]-3H-benzimidazole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 122690368) has the molecular formula C27H29F3N4O5 and a molecular weight of 546.55 g/mol. Its IUPAC name is N-hydroxy-2-[1-[(3-methoxypropylamino)methyl]-4-phenylcyclohexa-2,4-dien-1-yl]-3H-benzimidazole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-2-[1-[(3-methoxypropylamino)methyl]-4-phenylcyclohexa-2,4-dien-1-yl]-3H-benzimidazole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 122690368 |
| Molecular Formula | C27H29F3N4O5 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N-hydroxy-2-[1-[(3-methoxypropylamino)methyl]-4-phenylcyclohexa-2,4-dien-1-yl]-3H-benzimidazole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCCNCC1(c2nc3ccc(C(=O)NO)cc3[nH]2)C=CC(c2ccccc2)=CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N4O3.C2HF3O2/c1-32-15-5-14-26-17-25(12-10-19(11-13-25)18-6-3-2-4-7-18)24-27-21-9-8-20(23(30)29-31)16-22(21)28-24;3-2(4,5)1(6)7/h2-4,6-12,16,26,31H,5,13-15,17H2,1H3,(H,27,28)(H,29,30);(H,6,7) |
| InChIKey | RNBITNZRSLYVBF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 136.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|