C21H19F3N2O4S — CID 175391213
4-hydroxy-3-(methanesulfonamido)-N-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzamide (PubChem CID 175391213) has the molecular formula C21H19F3N2O4S and a molecular weight of 452.45 g/mol. Its IUPAC name is 4-hydroxy-3-(methanesulfonamido)-N-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzamide.
| Compound Name | 4-hydroxy-3-(methanesulfonamido)-N-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzamide |
|---|---|
| PubChem CID | 175391213 |
| Molecular Formula | C21H19F3N2O4S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 4-hydroxy-3-(methanesulfonamido)-N-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)NC2(C(F)(F)F)C=CC(c3ccccc3)=CC2)ccc1O |
| InChI | InChI=1S/C21H19F3N2O4S/c1-31(29,30)26-17-13-16(7-8-18(17)27)19(28)25-20(21(22,23)24)11-9-15(10-12-20)14-5-3-2-4-6-14/h2-11,13,26-27H,12H2,1H3,(H,25,28) |
| InChIKey | VCCNPSYUPUVZDT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|