C22H18N4O4S — CID 122690725
8-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylsulfonyl-3-pyridinyl)quinoxalin-6-amine (PubChem CID 122690725) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 8-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylsulfonyl-3-pyridinyl)quinoxalin-6-amine.
| Compound Name | 8-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylsulfonyl-3-pyridinyl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 122690725 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 8-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylsulfonyl-3-pyridinyl)quinoxalin-6-amine |
| SMILES | CS(=O)(=O)c1ccncc1-c1cnc2cc(N)cc(-c3ccc4c(c3)OCCO4)c2n1 |
| InChI | InChI=1S/C22H18N4O4S/c1-31(27,28)21-4-5-24-11-16(21)18-12-25-17-10-14(23)9-15(22(17)26-18)13-2-3-19-20(8-13)30-7-6-29-19/h2-5,8-12H,6-7,23H2,1H3 |
| InChIKey | INXLRHFXGBMRLW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|