C14H17N3OS — CID 122693163
1-(2-tert-butyl-1,3-thiazol-5-yl)-3-phenylurea (PubChem CID 122693163) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-thiazol-5-yl)-3-phenylurea.
| Compound Name | 1-(2-tert-butyl-1,3-thiazol-5-yl)-3-phenylurea |
|---|---|
| PubChem CID | 122693163 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(2-tert-butyl-1,3-thiazol-5-yl)-3-phenylurea |
| SMILES | CC(C)(C)c1ncc(NC(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C14H17N3OS/c1-14(2,3)12-15-9-11(19-12)17-13(18)16-10-7-5-4-6-8-10/h4-9H,1-3H3,(H2,16,17,18) |
| InChIKey | DIIGSNIHWVIIGL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |