C7H13NO2 — CID 122703349
2-methoxy-N,1-dimethylcyclopropane-1-carboxamide (PubChem CID 122703349) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-methoxy-N,1-dimethylcyclopropane-1-carboxamide.
| Compound Name | 2-methoxy-N,1-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 122703349 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-methoxy-N,1-dimethylcyclopropane-1-carboxamide |
| SMILES | CNC(=O)C1(C)CC1OC |
| InChI | InChI=1S/C7H13NO2/c1-7(6(9)8-2)4-5(7)10-3/h5H,4H2,1-3H3,(H,8,9) |
| InChIKey | SAWYWVJHDAPOPE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |