About 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide
1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide (PubChem CID 170150593) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide |
| PubChem CID | 170150593 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide |
| SMILES | CNC(=O)C1(C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C11H21NO/c1-9(2,3)11(8(13)12-6)7-10(11,4)5/h7H2,1-6H3,(H,12,13) |
| InChIKey | DKEBLKFROYUQKB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide?
The IUPAC name of 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide (CID 170150593) is 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide.
What is the SMILES notation for 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide?
The canonical SMILES for 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide is CNC(=O)C1(C(C)(C)C)CC1(C)C.
What is the InChIKey of 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide?
The InChIKey is DKEBLKFROYUQKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-9(2,3)11(8(13)12-6)7-10(11,4)5/h7H2,1-6H3,(H,12,13).
What are the key properties of 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide?
1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide has a molecular weight of 183.29 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-N,2,2-trimethylcyclopropane-1-carboxamide is sourced from PubChem (CID 170150593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).