C13H8BrF2N5O — CID 122704363
N-(5-bromo-2,4-difluorophenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 122704363) has the molecular formula C13H8BrF2N5O and a molecular weight of 368.14 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 122704363 |
| Molecular Formula | C13H8BrF2N5O |
| Molecular Weight | 368.14 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | [H]/N=C(/c1ccnc2nc[nH]c12)N(O)c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C13H8BrF2N5O/c14-7-3-10(9(16)4-8(7)15)21(22)12(17)6-1-2-18-13-11(6)19-5-20-13/h1-5,17,22H,(H,18,19,20)/b17-12- |
| InChIKey | AAABXCZKRZSSNG-ATVHPVEESA-N |
| XLogP | 3.22 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|