C11H18N2O — CID 12274570
N-cyclohex-2-en-1-ylpyrrolidine-1-carboxamide (PubChem CID 12274570) has the molecular formula C11H18N2O and a molecular weight of 194.27 g/mol. Its IUPAC name is N-cyclohex-2-en-1-ylpyrrolidine-1-carboxamide.
| Compound Name | N-cyclohex-2-en-1-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 12274570 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-cyclohex-2-en-1-ylpyrrolidine-1-carboxamide |
| SMILES | C1CCN(C1)C(=O)NC2CCCC=C2 |
| InChI | InChI=1S/C11H18N2O/c14-11(13-8-4-5-9-13)12-10-6-2-1-3-7-10/h2,6,10H,1,3-5,7-9H2,(H,12,14) |
| InChIKey | QYBKCDWWKIVPDO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 231 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|