C8H3ClIN3 — CID 123135383
5-chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile (PubChem CID 123135383) has the molecular formula C8H3ClIN3 and a molecular weight of 303.49 g/mol. Its IUPAC name is 5-chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile.
| Compound Name | 5-chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 123135383 |
| Molecular Formula | C8H3ClIN3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 302.91 |
| IUPAC Name | 5-chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile |
| SMILES | N#Cc1nc2[nH]cc(I)c2cc1Cl |
| InChI | InChI=1S/C8H3ClIN3/c9-5-1-4-6(10)3-12-8(4)13-7(5)2-11/h1,3H,(H,12,13) |
| InChIKey | DWYVXZQOUHSQIS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|