C29H28N2O2+2 — CID 123137068
1-hexyl-3-(2-naphthalen-2-ylethyl)benzo[f]benzimidazole-1,3-diium-4,9-dione (PubChem CID 123137068) has the molecular formula C29H28N2O2+2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-hexyl-3-(2-naphthalen-2-ylethyl)benzo[f]benzimidazole-1,3-diium-4,9-dione.
| Compound Name | 1-hexyl-3-(2-naphthalen-2-ylethyl)benzo[f]benzimidazole-1,3-diium-4,9-dione |
|---|---|
| PubChem CID | 123137068 |
| Molecular Formula | C29H28N2O2+2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-hexyl-3-(2-naphthalen-2-ylethyl)benzo[f]benzimidazole-1,3-diium-4,9-dione |
| SMILES | CCCCCC[N+]1=C=[N+](CCc2ccc3ccccc3c2)C2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H28N2O2/c1-2-3-4-9-17-30-20-31(18-16-21-14-15-22-10-5-6-11-23(22)19-21)27-26(30)28(32)24-12-7-8-13-25(24)29(27)33/h5-8,10-15,19H,2-4,9,16-18H2,1H3/q+2 |
| InChIKey | QHNAINWGUBUPRG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|