About 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one
4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one (PubChem CID 123138256) has the molecular formula C8H9NO2
and a molecular weight of 151.17 g/mol. Its IUPAC name is 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one.
Analyze 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one?
The IUPAC name of 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one (CID 123138256) is 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one.
What is the SMILES notation for 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one?
The canonical SMILES for 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one is CC1CC=NC2=C1C(=O)OC2.
What is the InChIKey of 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one?
The InChIKey is SDXPLZTXUAONDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-5-2-3-9-6-4-11-8(10)7(5)6/h3,5H,2,4H2,1H3.
What are the key properties of 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one?
4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one has a molecular weight of 151.17 g/mol, XLogP of 0.91, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4,7-dihydro-3H-furo[3,4-b]pyridin-5-one is sourced from PubChem (CID 123138256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).