About 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione
7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione (PubChem CID 130028271) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione.
Analyze 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione?
The IUPAC name of 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione (CID 130028271) is 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione.
What is the SMILES notation for 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione?
The canonical SMILES for 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione is CC1C(=O)CCC2=C1C(=O)OC2.
What is the InChIKey of 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione?
The InChIKey is UUZIPJYRNIGDOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-5-7(10)3-2-6-4-12-9(11)8(5)6/h5H,2-4H2,1H3.
What are the key properties of 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione?
7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione has a molecular weight of 166.18 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3,4,5,7-tetrahydro-2-benzofuran-1,6-dione is sourced from PubChem (CID 130028271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).