C11H15NS — CID 123140139
6-methyl-2-propyl-3a,4-dihydro-1,3-benzothiazole (PubChem CID 123140139) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 6-methyl-2-propyl-3a,4-dihydro-1,3-benzothiazole.
| Compound Name | 6-methyl-2-propyl-3a,4-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 123140139 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-methyl-2-propyl-3a,4-dihydro-1,3-benzothiazole |
| SMILES | CCCC1=NC2CC=C(C)C=C2S1 |
| InChI | InChI=1S/C11H15NS/c1-3-4-11-12-9-6-5-8(2)7-10(9)13-11/h5,7,9H,3-4,6H2,1-2H3 |
| InChIKey | YXDDODUVSJCECN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |