C20H33F2N3O2 — CID 123140818
[4-[1-(3,3-difluorocyclopentyl)-3-ethylpyrazol-5-yl]piperidin-1-yl]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 123140818) has the molecular formula C20H33F2N3O2 and a molecular weight of 385.50 g/mol. Its IUPAC name is [4-[1-(3,3-difluorocyclopentyl)-3-ethylpyrazol-5-yl]piperidin-1-yl]-[(2-methylpropan-2-yl)oxy]methanol.
| Compound Name | [4-[1-(3,3-difluorocyclopentyl)-3-ethylpyrazol-5-yl]piperidin-1-yl]-[(2-methylpropan-2-yl)oxy]methanol |
|---|---|
| PubChem CID | 123140818 |
| Molecular Formula | C20H33F2N3O2 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | [4-[1-(3,3-difluorocyclopentyl)-3-ethylpyrazol-5-yl]piperidin-1-yl]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | CCc1cc(C2CCN(C(O)OC(C)(C)C)CC2)n(C2CCC(F)(F)C2)n1 |
| InChI | InChI=1S/C20H33F2N3O2/c1-5-15-12-17(25(23-15)16-6-9-20(21,22)13-16)14-7-10-24(11-8-14)18(26)27-19(2,3)4/h12,14,16,18,26H,5-11,13H2,1-4H3 |
| InChIKey | UZYWHSMSFQHTDL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|