C11H20N2 — CID 123142909
(4Z)-4-[(butan-2-ylideneamino)methylidene]hex-5-en-1-amine (PubChem CID 123142909) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (4Z)-4-[(butan-2-ylideneamino)methylidene]hex-5-en-1-amine.
| Compound Name | (4Z)-4-[(butan-2-ylideneamino)methylidene]hex-5-en-1-amine |
|---|---|
| PubChem CID | 123142909 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (4Z)-4-[(butan-2-ylideneamino)methylidene]hex-5-en-1-amine |
| SMILES | C=C/C(=C\N=C(/C)CC)CCCN |
| InChI | InChI=1S/C11H20N2/c1-4-10(3)13-9-11(5-2)7-6-8-12/h5,9H,2,4,6-8,12H2,1,3H3/b11-9+,13-10+ |
| InChIKey | UJKKBNXEMKLCQL-HOJJKJLFSA-N |
| XLogP | 2.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|