About 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate
5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate (PubChem CID 123143046) has the molecular formula C13H19O6S-
and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate |
| PubChem CID | 123143046 |
| Molecular Formula | C13H19O6S- |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate |
| SMILES | CCC(C)c1c(C)c(S(=O)(=O)[O-])c(O)c(OC)c1OC |
| InChI | InChI=1S/C13H20O6S/c1-6-7(2)9-8(3)13(20(15,16)17)10(14)12(19-5)11(9)18-4/h7,14H,6H2,1-5H3,(H,15,16,17)/p-1 |
| InChIKey | QUTWWRYPNWJZQU-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate?
The IUPAC name of 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate (CID 123143046) is 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate.
What is the SMILES notation for 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate?
The canonical SMILES for 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate is CCC(C)c1c(C)c(S(=O)(=O)[O-])c(O)c(OC)c1OC.
What is the InChIKey of 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate?
The InChIKey is QUTWWRYPNWJZQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H20O6S/c1-6-7(2)9-8(3)13(20(15,16)17)10(14)12(19-5)11(9)18-4/h7,14H,6H2,1-5H3,(H,15,16,17)/p-1.
What are the key properties of 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate?
5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate has a molecular weight of 303.36 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-2-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonate is sourced from PubChem (CID 123143046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).