C15H24O6S — CID 118530257
2-butan-2-yl-3-hydroxy-4,5-dimethoxy-6-propylbenzenesulfonic acid (PubChem CID 118530257) has the molecular formula C15H24O6S and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-butan-2-yl-3-hydroxy-4,5-dimethoxy-6-propylbenzenesulfonic acid.
| Compound Name | 2-butan-2-yl-3-hydroxy-4,5-dimethoxy-6-propylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118530257 |
| Molecular Formula | C15H24O6S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-butan-2-yl-3-hydroxy-4,5-dimethoxy-6-propylbenzenesulfonic acid |
| SMILES | CCCc1c(OC)c(OC)c(O)c(C(C)CC)c1S(=O)(=O)O |
| InChI | InChI=1S/C15H24O6S/c1-6-8-10-13(20-4)14(21-5)12(16)11(9(3)7-2)15(10)22(17,18)19/h9,16H,6-8H2,1-5H3,(H,17,18,19) |
| InChIKey | WHOKYEOATAZYDW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|