C27H48O6S — CID 90329859
3-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-2,6-dimethoxy-4-propylbenzenesulfonic acid (PubChem CID 90329859) has the molecular formula C27H48O6S and a molecular weight of 500.74 g/mol. Its IUPAC name is 3-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-2,6-dimethoxy-4-propylbenzenesulfonic acid.
| Compound Name | 3-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-2,6-dimethoxy-4-propylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90329859 |
| Molecular Formula | C27H48O6S |
| Molecular Weight | 500.74 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 3-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-2,6-dimethoxy-4-propylbenzenesulfonic acid |
| SMILES | CCCc1c(O)c(OC)c(S(=O)(=O)O)c(OC)c1C(C(C)(C)CC(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C27H48O6S/c1-13-14-18-19(21(32-11)23(34(29,30)31)22(33-12)20(18)28)24(26(7,8)15-17(2)3)27(9,10)16-25(4,5)6/h17,24,28H,13-16H2,1-12H3,(H,29,30,31) |
| InChIKey | XWWRLZKXTWHGLO-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|