C26H46O5S — CID 144675842
3-ethyl-2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-6-methoxy-4-methylbenzenesulfonic acid (PubChem CID 144675842) has the molecular formula C26H46O5S and a molecular weight of 470.72 g/mol. Its IUPAC name is 3-ethyl-2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-6-methoxy-4-methylbenzenesulfonic acid.
| Compound Name | 3-ethyl-2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-6-methoxy-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 144675842 |
| Molecular Formula | C26H46O5S |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 3-ethyl-2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-6-methoxy-4-methylbenzenesulfonic acid |
| SMILES | CCc1c(C)c(O)c(OC)c(S(=O)(=O)O)c1C(C(C)(C)CC(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C26H46O5S/c1-13-18-17(4)20(27)21(31-12)22(32(28,29)30)19(18)23(25(8,9)14-16(2)3)26(10,11)15-24(5,6)7/h16,23,27H,13-15H2,1-12H3,(H,28,29,30) |
| InChIKey | FMHKJSDSHNMDMD-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|