C26H46O6S — CID 90329930
2-ethyl-6-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-4-hydroxy-3,5-dimethoxybenzenesulfonic acid (PubChem CID 90329930) has the molecular formula C26H46O6S and a molecular weight of 486.72 g/mol. Its IUPAC name is 2-ethyl-6-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-4-hydroxy-3,5-dimethoxybenzenesulfonic acid.
| Compound Name | 2-ethyl-6-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-4-hydroxy-3,5-dimethoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 90329930 |
| Molecular Formula | C26H46O6S |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 2-ethyl-6-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-4-hydroxy-3,5-dimethoxybenzenesulfonic acid |
| SMILES | CCc1c(OC)c(O)c(OC)c(C(C(C)(C)CC(C)C)C(C)(C)CC(C)(C)C)c1S(=O)(=O)O |
| InChI | InChI=1S/C26H46O6S/c1-13-17-20(31-11)19(27)21(32-12)18(22(17)33(28,29)30)23(25(7,8)14-16(2)3)26(9,10)15-24(4,5)6/h16,23,27H,13-15H2,1-12H3,(H,28,29,30) |
| InChIKey | QKJQRDKSFALZKC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|