C27H48O5S — CID 144675802
2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-4-hydroxy-5-methoxy-3-methyl-6-propylbenzenesulfonic acid (PubChem CID 144675802) has the molecular formula C27H48O5S and a molecular weight of 484.74 g/mol. Its IUPAC name is 2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-4-hydroxy-5-methoxy-3-methyl-6-propylbenzenesulfonic acid.
| Compound Name | 2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-4-hydroxy-5-methoxy-3-methyl-6-propylbenzenesulfonic acid |
|---|---|
| PubChem CID | 144675802 |
| Molecular Formula | C27H48O5S |
| Molecular Weight | 484.74 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-4-hydroxy-5-methoxy-3-methyl-6-propylbenzenesulfonic acid |
| SMILES | CCCc1c(OC)c(O)c(C)c(C(C(C)(C)CC(C)C)C(C)(C)CC(C)(C)C)c1S(=O)(=O)O |
| InChI | InChI=1S/C27H48O5S/c1-13-14-19-22(32-12)21(28)18(4)20(23(19)33(29,30)31)24(26(8,9)15-17(2)3)27(10,11)16-25(5,6)7/h17,24,28H,13-16H2,1-12H3,(H,29,30,31) |
| InChIKey | JMDVEPXKUOGDEH-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.74 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|