C13H20O6S — CID 118530241
3-butan-2-yl-2-hydroxy-4,5-dimethoxy-6-methylbenzenesulfonic acid (PubChem CID 118530241) has the molecular formula C13H20O6S and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-butan-2-yl-2-hydroxy-4,5-dimethoxy-6-methylbenzenesulfonic acid.
| Compound Name | 3-butan-2-yl-2-hydroxy-4,5-dimethoxy-6-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118530241 |
| Molecular Formula | C13H20O6S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-butan-2-yl-2-hydroxy-4,5-dimethoxy-6-methylbenzenesulfonic acid |
| SMILES | CCC(C)c1c(O)c(S(=O)(=O)O)c(C)c(OC)c1OC |
| InChI | InChI=1S/C13H20O6S/c1-6-7(2)9-10(14)13(20(15,16)17)8(3)11(18-4)12(9)19-5/h7,14H,6H2,1-5H3,(H,15,16,17) |
| InChIKey | FHHMTWWRTSHGFM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|