C15H27N2+ — CID 123143705
4-butan-2-yl-1,1-dimethyl-3,7,8,9-tetrahydro-2H-cyclohepta[b]pyrazin-1-ium (PubChem CID 123143705) has the molecular formula C15H27N2+ and a molecular weight of 235.39 g/mol. Its IUPAC name is 4-butan-2-yl-1,1-dimethyl-3,7,8,9-tetrahydro-2H-cyclohepta[b]pyrazin-1-ium.
| Compound Name | 4-butan-2-yl-1,1-dimethyl-3,7,8,9-tetrahydro-2H-cyclohepta[b]pyrazin-1-ium |
|---|---|
| PubChem CID | 123143705 |
| Molecular Formula | C15H27N2+ |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.22 |
| IUPAC Name | 4-butan-2-yl-1,1-dimethyl-3,7,8,9-tetrahydro-2H-cyclohepta[b]pyrazin-1-ium |
| SMILES | CCC(C)N1CC[N+](C)(C)C2=C1C=CCCC2 |
| InChI | InChI=1S/C15H27N2/c1-5-13(2)16-11-12-17(3,4)15-10-8-6-7-9-14(15)16/h7,9,13H,5-6,8,10-12H2,1-4H3/q+1 |
| InChIKey | WGOOYUCWHMNQIM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|